![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | 100_2283.jpg.gz | 2005-07-23 23:24 | 370K | |
![[ ]](/icons/compressed.gif) | 100_2286.jpg.gz | 2005-07-23 23:24 | 471K | |
![[ ]](/icons/compressed.gif) | 100_2313.jpg.gz | 2005-07-23 23:24 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2331.jpg.gz | 2005-07-23 23:24 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2351.jpg.gz | 2005-07-23 23:24 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2379.jpg.gz | 2005-07-23 23:24 | 1.5M | |
![[ ]](/icons/compressed.gif) | 100_2381.jpg.gz | 2005-07-23 23:24 | 840K | |
![[ ]](/icons/compressed.gif) | 100_2389.jpg.gz | 2005-07-23 23:24 | 1.3M | |
![[ ]](/icons/compressed.gif) | 100_2393.jpg.gz | 2005-07-23 23:24 | 1.7M | |
![[ ]](/icons/compressed.gif) | 100_2395.jpg.gz | 2005-07-23 23:24 | 1.4M | |
![[ ]](/icons/compressed.gif) | 100_2400.jpg.gz | 2005-07-23 23:25 | 1.4M | |
![[ ]](/icons/compressed.gif) | 100_2402.jpg.gz | 2005-07-23 23:25 | 1.5M | |
![[ ]](/icons/compressed.gif) | 100_2407.jpg.gz | 2005-07-23 23:25 | 1.5M | |
![[ ]](/icons/compressed.gif) | 100_2417.jpg.gz | 2005-07-23 23:25 | 536K | |
![[ ]](/icons/compressed.gif) | 100_2442 copy.jpg.gz | 2005-07-23 23:25 | 1.3M | |
![[ ]](/icons/compressed.gif) | 100_2451.jpg.gz | 2005-07-23 23:25 | 1.9M | |
![[ ]](/icons/compressed.gif) | 100_2492.jpg.gz | 2005-07-23 23:25 | 1.9M | |
![[ ]](/icons/compressed.gif) | 100_2497.jpg.gz | 2005-07-23 23:25 | 637K | |
![[ ]](/icons/compressed.gif) | 100_2498.jpg.gz | 2005-07-23 23:25 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2500.jpg.gz | 2005-07-23 23:25 | 1.7M | |
![[ ]](/icons/compressed.gif) | 100_2502.jpg.gz | 2005-07-23 23:25 | 1.4M | |
![[ ]](/icons/compressed.gif) | 100_2508.jpg.gz | 2005-07-23 23:25 | 1.9M | |
![[ ]](/icons/compressed.gif) | 100_2512.jpg.gz | 2005-07-23 23:25 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2523.jpg.gz | 2005-07-23 23:25 | 634K | |
![[ ]](/icons/compressed.gif) | 100_2577.JPG.jpg.gz | 2005-07-23 23:25 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2580.JPG.jpg.gz | 2005-07-23 23:25 | 910K | |
![[ ]](/icons/compressed.gif) | 100_2595.JPG.jpg.gz | 2005-07-23 23:25 | 551K | |
![[ ]](/icons/compressed.gif) | 100_2597.JPG.jpg.gz | 2005-07-23 23:25 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2600.JPG.jpg.gz | 2005-07-23 23:25 | 601K | |
![[ ]](/icons/compressed.gif) | 100_2601.JPG.jpg.gz | 2005-07-23 23:25 | 140K | |
![[ ]](/icons/compressed.gif) | 100_2601.JPG copy.jpg.gz | 2005-07-23 23:25 | 182K | |
![[ ]](/icons/compressed.gif) | 100_2601.JPG copy_1.jpg.gz | 2005-07-23 23:25 | 611K | |
![[ ]](/icons/compressed.gif) | 100_2603.JPG.jpg.gz | 2005-07-23 23:25 | 1.7M | |
![[ ]](/icons/compressed.gif) | 100_2604.JPG copy.jpg.gz | 2005-07-23 23:25 | 632K | |
![[ ]](/icons/compressed.gif) | 100_2606.JPG.jpg.gz | 2005-07-23 23:25 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2608.JPG.jpg.gz | 2005-07-23 23:25 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2609.JPG.jpg.gz | 2005-07-23 23:25 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2610.JPG.jpg.gz | 2005-07-23 23:25 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2612.JPG.jpg.gz | 2005-07-23 23:25 | 581K | |
![[ ]](/icons/compressed.gif) | 100_2613.JPG.jpg.gz | 2005-07-23 23:25 | 582K | |
![[ ]](/icons/compressed.gif) | 100_2618.JPG.jpg.gz | 2005-07-23 23:25 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2619.JPG.jpg.gz | 2005-07-23 23:25 | 1.7M | |
![[ ]](/icons/compressed.gif) | 100_2621.JPG.jpg.gz | 2005-07-23 23:25 | 660K | |
![[ ]](/icons/compressed.gif) | 100_2622.JPG.jpg.gz | 2005-07-23 23:25 | 544K | |
![[ ]](/icons/compressed.gif) | 100_2623.JPG.jpg.gz | 2005-07-23 23:25 | 657K | |
![[ ]](/icons/compressed.gif) | 100_2624.JPG.jpg.gz | 2005-07-23 23:25 | 661K | |
![[ ]](/icons/compressed.gif) | 100_2625.JPG.jpg.gz | 2005-07-23 23:25 | 742K | |
![[ ]](/icons/compressed.gif) | 100_2626.JPG.jpg.gz | 2005-07-23 23:25 | 895K | |
![[ ]](/icons/compressed.gif) | 100_2627.JPG.jpg.gz | 2005-07-23 23:25 | 761K | |
![[ ]](/icons/compressed.gif) | 100_2628.JPG.jpg.gz | 2005-07-23 23:25 | 759K | |
![[ ]](/icons/compressed.gif) | 100_2629.JPG.jpg.gz | 2005-07-23 23:25 | 627K | |
![[ ]](/icons/compressed.gif) | 100_2630.JPG.jpg.gz | 2005-07-23 23:25 | 870K | |
![[ ]](/icons/compressed.gif) | 100_2631.JPG.jpg.gz | 2005-07-23 23:26 | 679K | |
![[ ]](/icons/compressed.gif) | 100_2632.JPG.jpg.gz | 2005-07-23 23:26 | 951K | |
![[ ]](/icons/compressed.gif) | 100_2633.JPG.jpg.gz | 2005-07-23 23:26 | 1.3M | |
![[ ]](/icons/compressed.gif) | 100_2639.JPG.jpg.gz | 2005-07-23 23:26 | 742K | |
![[ ]](/icons/compressed.gif) | 100_2640.JPG.jpg.gz | 2005-07-23 23:26 | 503K | |
![[ ]](/icons/compressed.gif) | 100_2642.JPG.jpg.gz | 2005-07-23 23:26 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2643.JPG.jpg.gz | 2005-07-23 23:26 | 1.4M | |
![[ ]](/icons/compressed.gif) | 100_2644.JPG.jpg.gz | 2005-07-23 23:26 | 909K | |
![[ ]](/icons/compressed.gif) | 100_2647.JPG.jpg.gz | 2005-07-23 23:26 | 713K | |
![[ ]](/icons/compressed.gif) | 100_2650.JPG.jpg.gz | 2005-07-23 23:26 | 941K | |
![[ ]](/icons/compressed.gif) | 100_2651.JPG.jpg.gz | 2005-07-23 23:26 | 754K | |
![[ ]](/icons/compressed.gif) | 100_2652.JPG.jpg.gz | 2005-07-23 23:26 | 608K | |
![[ ]](/icons/compressed.gif) | 100_2653.JPG.jpg.gz | 2005-07-23 23:26 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2654.JPG.jpg.gz | 2005-07-23 23:26 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2655.JPG.jpg.gz | 2005-07-23 23:26 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2656.JPG.jpg.gz | 2005-07-23 23:26 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2658.JPG.jpg.gz | 2005-07-23 23:26 | 1.3M | |
![[ ]](/icons/compressed.gif) | 100_2659.JPG.jpg.gz | 2005-07-23 23:26 | 677K | |
![[ ]](/icons/compressed.gif) | 100_2660.JPG.jpg.gz | 2005-07-23 23:26 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2662.JPG.jpg.gz | 2005-07-23 23:26 | 710K | |
![[ ]](/icons/compressed.gif) | 100_2663.JPG.jpg.gz | 2005-07-23 23:26 | 649K | |
![[ ]](/icons/compressed.gif) | 100_2675.JPG.jpg.gz | 2005-07-23 23:26 | 933K | |
![[ ]](/icons/compressed.gif) | 100_2676.JPG.jpg.gz | 2005-07-23 23:26 | 1.0M | |
![[ ]](/icons/compressed.gif) | 100_2677.JPG.jpg.gz | 2005-07-23 23:26 | 576K | |
![[ ]](/icons/compressed.gif) | 100_2678.JPG.jpg.gz | 2005-07-23 23:26 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2681.JPG.jpg.gz | 2005-07-23 23:26 | 448K | |
![[ ]](/icons/compressed.gif) | 100_2682.JPG.jpg.gz | 2005-07-23 23:26 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2683.JPG.jpg.gz | 2005-07-23 23:26 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2685.JPG.jpg.gz | 2005-07-23 23:27 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2686.JPG.jpg.gz | 2005-07-23 23:27 | 521K | |
![[ ]](/icons/compressed.gif) | 100_2687.JPG.jpg.gz | 2005-07-23 23:27 | 1.3M | |
![[ ]](/icons/compressed.gif) | 100_2688.JPG.jpg.gz | 2005-07-23 23:27 | 583K | |
![[ ]](/icons/compressed.gif) | 100_2692.JPG.jpg.gz | 2005-07-23 23:27 | 356K | |
![[ ]](/icons/compressed.gif) | 100_2692.JPG copy.jpg.gz | 2005-07-23 23:27 | 891K | |
![[ ]](/icons/compressed.gif) | 100_2693.JPG.jpg.gz | 2005-07-23 23:27 | 1.4M | |
![[ ]](/icons/compressed.gif) | 100_2694.JPG.jpg.gz | 2005-07-23 23:27 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2695.JPG.jpg.gz | 2005-07-23 23:27 | 899K | |
![[ ]](/icons/compressed.gif) | 100_2696.JPG.jpg.gz | 2005-07-23 23:27 | 1.2M | |
![[ ]](/icons/compressed.gif) | 100_2699.JPG.jpg.gz | 2005-07-23 23:27 | 1.1M | |
![[ ]](/icons/compressed.gif) | 100_2700.JPG.jpg.gz | 2005-07-23 23:27 | 874K | |
![[ ]](/icons/compressed.gif) | 100_2701.JPG.jpg.gz | 2005-07-23 23:27 | 867K | |
![[ ]](/icons/compressed.gif) | 100_2702.JPG.jpg.gz | 2005-07-23 23:27 | 781K | |
![[ ]](/icons/compressed.gif) | 100_2703.JPG.jpg.gz | 2005-07-23 23:27 | 791K | |
![[ ]](/icons/compressed.gif) | 100_2704.JPG.jpg.gz | 2005-07-23 23:27 | 804K | |
![[ ]](/icons/compressed.gif) | 100_2705.JPG.jpg.gz | 2005-07-23 23:27 | 774K | |
![[ ]](/icons/compressed.gif) | 100_2706.JPG.jpg.gz | 2005-07-23 23:27 | 762K | |
![[ ]](/icons/compressed.gif) | Andrea.jpg.gz | 2005-07-23 23:27 | 257K | |
![[ ]](/icons/compressed.gif) | Andrew and Chester.jpg.gz | 2005-07-23 23:27 | 1.3M | |
![[ ]](/icons/compressed.gif) | Andrew and Laura.jpg.gz | 2005-07-23 23:27 | 286K | |
![[ ]](/icons/compressed.gif) | Andrew and Laura chillen in the fog copy.jpg.gz | 2005-07-23 23:27 | 208K | |
![[ ]](/icons/compressed.gif) | Andrew with a tree.jpg.gz | 2005-07-23 23:27 | 1.8M | |
![[ ]](/icons/compressed.gif) | Ashima the tiny girl.jpg.gz | 2005-07-23 23:27 | 1.0M | |
![[ ]](/icons/compressed.gif) | Aww, so cute.jpg.gz | 2005-07-23 23:27 | 1.0M | |
![[ ]](/icons/compressed.gif) | Axelle and I on the bus..jpg.gz | 2005-07-23 23:27 | 595K | |
![[ ]](/icons/compressed.gif) | Bethany .jpg.gz | 2005-07-23 23:27 | 286K | |
![[ ]](/icons/compressed.gif) | Beth in the humidity.jpg.gz | 2005-07-23 23:27 | 193K | |
![[ ]](/icons/compressed.gif) | Billy the cat.jpg.gz | 2005-07-23 23:27 | 935K | |
![[ ]](/icons/compressed.gif) | Calcutta rooftops.jpg.gz | 2005-07-23 23:27 | 1.8M | |
![[ ]](/icons/compressed.gif) | Chelsea.jpg.gz | 2005-07-23 23:27 | 315K | |
![[ ]](/icons/compressed.gif) | Chelsea and Andrew.jpg.gz | 2005-07-23 23:27 | 661K | |
![[ ]](/icons/compressed.gif) | Chelsea on the train.jpg.gz | 2005-07-23 23:27 | 93K | |
![[ ]](/icons/compressed.gif) | Cheryl.jpg.gz | 2005-07-23 23:27 | 1.2M | |
![[ ]](/icons/compressed.gif) | Chester.jpg.gz | 2005-07-23 23:27 | 359K | |
![[ ]](/icons/compressed.gif) | Chester and Andrew at Joey's.jpg.gz | 2005-07-23 23:27 | 1.1M | |
![[ ]](/icons/compressed.gif) | Chester at Dolly's.jpg.gz | 2005-07-23 23:27 | 731K | |
![[ ]](/icons/compressed.gif) | Chillin.jpg.gz | 2005-07-23 23:27 | 325K | |
![[ ]](/icons/compressed.gif) | Cumala.jpg.gz | 2005-07-23 23:27 | 1.5M | |
![[ ]](/icons/compressed.gif) | Cumula.jpg.gz | 2005-07-23 23:27 | 947K | |
![[ ]](/icons/compressed.gif) | Dalem.jpg.gz | 2005-07-23 23:27 | 971K | |
![[ ]](/icons/compressed.gif) | Darjeeling clouds.jpg.gz | 2005-07-23 23:27 | 406K | |
![[ ]](/icons/compressed.gif) | Darjeeling dog.jpg.gz | 2005-07-23 23:27 | 535K | |
![[ ]](/icons/compressed.gif) | Darjeeling graveyard.jpg.gz | 2005-07-23 23:27 | 2.0M | |
![[ ]](/icons/compressed.gif) | Darjeeling ropeway.jpg.gz | 2005-07-23 23:27 | 551K | |
![[ ]](/icons/compressed.gif) | Darjeeling trees.jpg.gz | 2005-07-23 23:27 | 1.2M | |
![[ ]](/icons/compressed.gif) | Esther in the fog.jpg.gz | 2005-07-23 23:27 | 607K | |
![[ ]](/icons/compressed.gif) | Freedomize ladies in darj.jpg.gz | 2005-07-23 23:27 | 380K | |
![[ ]](/icons/compressed.gif) | Gangtok.jpg.gz | 2005-07-23 23:27 | 928K | |
![[ ]](/icons/compressed.gif) | Heathrow.jpg.gz | 2005-07-23 23:27 | 744K | |
![[ ]](/icons/compressed.gif) | Indira Ghandi statue, Kolkata.jpg.gz | 2005-07-23 23:27 | 553K | |
![[ ]](/icons/compressed.gif) | Jam at Blue Sky.jpg.gz | 2005-07-23 23:27 | 409K | |
![[ ]](/icons/compressed.gif) | Kolkata traffic.jpg.gz | 2005-07-23 23:28 | 848K | |
![[ ]](/icons/compressed.gif) | Laura and Esther in Darjeeling.jpg.gz | 2005-07-23 23:28 | 934K | |
![[ ]](/icons/compressed.gif) | Laura at Blue Sky.jpg.gz | 2005-07-23 23:28 | 378K | |
![[ ]](/icons/compressed.gif) | Laura at the Fairlawn.jpg.gz | 2005-07-23 23:28 | 266K | |
![[ ]](/icons/compressed.gif) | Lisa and Esther in darjeeling.jpg.gz | 2005-07-23 23:28 | 690K | |
![[ ]](/icons/compressed.gif) | Liz.jpg.gz | 2005-07-23 23:28 | 359K | |
![[ ]](/icons/compressed.gif) | Liz and Andrew, take 2.jpg.gz | 2005-07-23 23:28 | 1.2M | |
![[ ]](/icons/compressed.gif) | Mona!.jpg.gz | 2005-07-23 23:28 | 1.6M | |
![[ ]](/icons/compressed.gif) | Palu!.jpg.gz | 2005-07-23 23:28 | 574K | |
![[ ]](/icons/compressed.gif) | Pizza hut.jpg.gz | 2005-07-23 23:28 | 542K | |
![[ ]](/icons/compressed.gif) | Salma.jpg.gz | 2005-07-23 23:28 | 905K | |
![[ ]](/icons/compressed.gif) | Sarah, Cumala, and Krystal.jpg.gz | 2005-07-23 23:28 | 676K | |
![[ ]](/icons/compressed.gif) | Sarah, Sister O, and Theresa.jpg.gz | 2005-07-23 23:28 | 1.0M | |
![[ ]](/icons/compressed.gif) | Sarah and Sister Olga.jpg.gz | 2005-07-23 23:28 | 602K | |
![[ ]](/icons/compressed.gif) | Shannon.jpg.gz | 2005-07-23 23:28 | 274K | |
![[ ]](/icons/compressed.gif) | Sita, making a broom.jpg.gz | 2005-07-23 23:28 | 550K | |
![[ ]](/icons/compressed.gif) | Tagore sign.jpg.gz | 2005-07-23 23:28 | 703K | |
![[ ]](/icons/compressed.gif) | Teresa, posing.jpg.gz | 2005-07-23 23:28 | 642K | |
![[ ]](/icons/compressed.gif) | Theresa and me.jpg.gz | 2005-07-23 23:28 | 1.0M | |
![[ ]](/icons/compressed.gif) | The virgin statue at Shanti Dan.jpg.gz | 2005-07-23 23:28 | 1.3M | |
![[ ]](/icons/compressed.gif) | Tibetan kids.jpg.gz | 2005-07-23 23:28 | 525K | |
![[ ]](/icons/compressed.gif) | Tibetan ladies knitting.jpg.gz | 2005-07-23 23:28 | 803K | |
![[ ]](/icons/compressed.gif) | Tibetan woman .jpg.gz | 2005-07-23 23:28 | 388K | |
![[ ]](/icons/compressed.gif) | a freaking cool yarn winder.jpg.gz | 2005-07-23 23:28 | 459K | |
![[ ]](/icons/compressed.gif) | a monument in gangtok.jpg.gz | 2005-07-23 23:28 | 332K | |
![[ ]](/icons/compressed.gif) | a monument in gangtok copy.jpg.gz | 2005-07-23 23:28 | 1.2M | |
![[ ]](/icons/compressed.gif) | and that was just weird..jpg.gz | 2005-07-23 23:28 | 749K | |
![[ ]](/icons/compressed.gif) | another attempt at Everest.jpg.gz | 2005-07-23 23:28 | 840K | |
![[ ]](/icons/compressed.gif) | another leopard.jpg.gz | 2005-07-23 23:28 | 972K | |
![[ ]](/icons/compressed.gif) | at the cedar inn.jpg.gz | 2005-07-23 23:28 | 897K | |
![[ ]](/icons/compressed.gif) | buddhist monastery.jpg.gz | 2005-07-23 23:28 | 1.2M | |
![[ ]](/icons/compressed.gif) | butterfly closeup copy.jpg.gz | 2005-07-23 23:28 | 840K | |
![[ ]](/icons/compressed.gif) | cab ride.jpg.gz | 2005-07-23 23:28 | 362K | |
![[ ]](/icons/compressed.gif) | cleaning the floors.jpg.gz | 2005-07-23 23:28 | 1.1M | |
![[ ]](/icons/compressed.gif) | clipping toenails.jpg.gz | 2005-07-23 23:28 | 567K | |
![[ ]](/icons/compressed.gif) | clouds.jpg.gz | 2005-07-23 23:28 | 493K | |
![[ ]](/icons/compressed.gif) | dancing.jpg.gz | 2005-07-23 23:28 | 1.0M | |
![[ ]](/icons/compressed.gif) | dorks with toques.jpg.gz | 2005-07-23 23:28 | 791K | |
![[ ]](/icons/compressed.gif) | fancy hotel.jpg.gz | 2005-07-23 23:28 | 415K | |
![[ ]](/icons/compressed.gif) | first day off.jpg.gz | 2005-07-23 23:28 | 1.2M | |
![[ ]](/icons/compressed.gif) | first morning copy.jpg.gz | 2005-07-23 23:28 | 525K | |
![[ ]](/icons/compressed.gif) | flower, high contrast.jpg.gz | 2005-07-23 23:28 | 416K | |
![[ ]](/icons/compressed.gif) | flower, samsara gardens.jpg.gz | 2005-07-23 23:28 | 1.1M | |
![[ ]](/icons/compressed.gif) | fog, darjeeling zoo.jpg.gz | 2005-07-23 23:28 | 1.6M | |
![[ ]](/icons/compressed.gif) | foggy camera!.jpg.gz | 2005-07-23 23:28 | 205K | |
![[ ]](/icons/compressed.gif) | foggy doggie.jpg.gz | 2005-07-23 23:28 | 464K | |
![[ ]](/icons/compressed.gif) | freak-ay.jpg.gz | 2005-07-23 23:28 | 1.4M | |
![[ ]](/icons/compressed.gif) | from the Astoria's roof.jpg.gz | 2005-07-23 23:28 | 1.2M | |
![[ ]](/icons/compressed.gif) | gangtok_1.jpg.gz | 2005-07-23 23:28 | 1.2M | |
![[ ]](/icons/compressed.gif) | gangtok monument.jpg.gz | 2005-07-23 23:28 | 1.9M | |
![[ ]](/icons/compressed.gif) | gangtok mountains copy.jpg.gz | 2005-07-23 23:28 | 449K | |
![[ ]](/icons/compressed.gif) | gangtok traffic.jpg.gz | 2005-07-23 23:28 | 1.6M | |
![[ ]](/icons/compressed.gif) | girl from gangtok.jpg.gz | 2005-07-23 23:28 | 618K | |
![[ ]](/icons/compressed.gif) | glimpse of the toy train.jpg.gz | 2005-07-23 23:29 | 557K | |
![[ ]](/icons/compressed.gif) | hanging out at the sally anne.jpg.gz | 2005-07-23 23:29 | 1.0M | |
![[ ]](/icons/compressed.gif) | home for orphans.jpg.gz | 2005-07-23 23:29 | 778K | |
![[ ]](/icons/compressed.gif) | homes on the street..jpg.gz | 2005-07-23 23:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | hot and stimuliating.jpg.gz | 2005-07-23 23:29 | 1.0M | |
![[ ]](/icons/compressed.gif) | i lost my seat.jpg.gz | 2005-07-23 23:29 | 915K | |
![[ ]](/icons/compressed.gif) | it's questionable....jpg.gz | 2005-07-23 23:29 | 221K | |
![[ ]](/icons/compressed.gif) | kind of like prayer flags.jpg.gz | 2005-07-23 23:29 | 916K | |
![[ ]](/icons/compressed.gif) | knitting.jpg.gz | 2005-07-23 23:29 | 463K | |
![[ ]](/icons/compressed.gif) | last night at Pizza Hut.jpg.gz | 2005-07-23 23:29 | 1.2M | |
![[ ]](/icons/compressed.gif) | laundry.jpg.gz | 2005-07-23 23:29 | 601K | |
![[ ]](/icons/compressed.gif) | laura and esther .jpg.gz | 2005-07-23 23:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | leopard.jpg.gz | 2005-07-23 23:29 | 860K | |
![[ ]](/icons/compressed.gif) | lisa and laura and HMI.jpg.gz | 2005-07-23 23:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | little girl in Gangtok.jpg.gz | 2005-07-23 23:29 | 1.3M | |
![[ ]](/icons/compressed.gif) | liz and andrew.jpg.gz | 2005-07-23 23:29 | 1.7M | |
![[ ]](/icons/compressed.gif) | making brooms.jpg.gz | 2005-07-23 23:29 | 635K | |
![[ ]](/icons/compressed.gif) | making cards.jpg.gz | 2005-07-23 23:29 | 1.0M | |
![[ ]](/icons/compressed.gif) | me and Chester.jpg.gz | 2005-07-23 23:29 | 388K | |
![[ ]](/icons/compressed.gif) | me and liz.jpg.gz | 2005-07-23 23:29 | 629K | |
![[ ]](/icons/compressed.gif) | monastery.jpg.gz | 2005-07-23 23:29 | 1.4M | |
![[ ]](/icons/compressed.gif) | monastery detail.jpg.gz | 2005-07-23 23:29 | 1.6M | |
![[ ]](/icons/compressed.gif) | monastery dog.jpg.gz | 2005-07-23 23:29 | 932K | |
![[ ]](/icons/compressed.gif) | monkeys.jpg.gz | 2005-07-23 23:29 | 1.2M | |
![[ ]](/icons/compressed.gif) | monster toenails!.jpg.gz | 2005-07-23 23:29 | 403K | |
![[ ]](/icons/compressed.gif) | more children.jpg.gz | 2005-07-23 23:29 | 1.6M | |
![[ ]](/icons/compressed.gif) | more prayer flags.jpg.gz | 2005-07-23 23:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | on the bus.jpg.gz | 2005-07-23 23:29 | 340K | |
![[ ]](/icons/compressed.gif) | painting nails.jpg.gz | 2005-07-23 23:29 | 1.4M | |
![[ ]](/icons/compressed.gif) | palm tree group hug, Gangtok.jpg.gz | 2005-07-23 23:29 | 1.5M | |
![[ ]](/icons/compressed.gif) | petroleum.jpg.gz | 2005-07-23 23:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | prayer flags (again!).jpg.gz | 2005-07-23 23:29 | 1.2M | |
![[ ]](/icons/compressed.gif) | prayer flags in the fog.jpg.gz | 2005-07-23 23:29 | 304K | |
![[ ]](/icons/compressed.gif) | prayer wheels.jpg.gz | 2005-07-23 23:29 | 902K | |
![[ ]](/icons/compressed.gif) | random kid in gangtok.jpg.gz | 2005-07-23 23:29 | 884K | |
![[ ]](/icons/compressed.gif) | random kids.jpg.gz | 2005-07-23 23:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | road to Darjeeling.jpg.gz | 2005-07-23 23:29 | 1.7M | |
![[ ]](/icons/compressed.gif) | saying good bye to Liz.jpg.gz | 2005-07-23 23:29 | 826K | |
![[ ]](/icons/compressed.gif) | shanti dan girls.jpg.gz | 2005-07-23 23:29 | 596K | |
![[ ]](/icons/compressed.gif) | sit still!.jpg.gz | 2005-07-23 23:29 | 1.0M | |
![[ ]](/icons/compressed.gif) | snack time.jpg.gz | 2005-07-23 23:29 | 1.2M | |
![[ ]](/icons/compressed.gif) | the gardener and her daughter.jpg.gz | 2005-07-23 23:30 | 626K | |
![[ ]](/icons/compressed.gif) | the gardener and her daughter copy.jpg.gz | 2005-07-23 23:30 | 2.0M | |
![[ ]](/icons/compressed.gif) | the girl who smiles.jpg.gz | 2005-07-23 23:30 | 799K | |
![[ ]](/icons/compressed.gif) | the girl with the crazy hair.jpg.gz | 2005-07-23 23:30 | 471K | |
![[ ]](/icons/compressed.gif) | the monastery up close.jpg.gz | 2005-07-23 23:30 | 1.5M | |
![[ ]](/icons/compressed.gif) | the new girl.jpg.gz | 2005-07-23 23:30 | 1.0M | |
![[ ]](/icons/compressed.gif) | the palm trees at Shanti Dan.jpg.gz | 2005-07-23 23:30 | 1.2M | |
![[ ]](/icons/compressed.gif) | the tiny lady.jpg.gz | 2005-07-23 23:30 | 961K | |
![[ ]](/icons/compressed.gif) | the twisty girl.jpg.gz | 2005-07-23 23:30 | 888K | |
![[ ]](/icons/compressed.gif) | three monks waiting.jpg.gz | 2005-07-23 23:30 | 780K | |
![[ ]](/icons/compressed.gif) | tibetan lady knitting BW.jpg.gz | 2005-07-23 23:30 | 359K | |
![[ ]](/icons/compressed.gif) | tibetan refugee cat.jpg.gz | 2005-07-23 23:30 | 544K | |
![[ ]](/icons/compressed.gif) | tree detail.jpg.gz | 2005-07-23 23:30 | 405K | |
![[ ]](/icons/compressed.gif) | trees in Gangtok.jpg.gz | 2005-07-23 23:30 | 798K | |
![[ ]](/icons/compressed.gif) | way to Shanti Dan.jpg.gz | 2005-07-23 23:30 | 830K | |
![[ ]](/icons/compressed.gif) | weird tree arc, Gangtok.jpg.gz | 2005-07-23 23:30 | 2.5M | |
![[ ]](/icons/compressed.gif) | white tiger.jpg.gz | 2005-07-23 23:30 | 1.5M | |
![[ ]](/icons/compressed.gif) | wild flower, Gangtok.jpg.gz | 2005-07-23 23:30 | 1.5M | |
![[ ]](/icons/compressed.gif) | wild flower in a tree.jpg.gz | 2005-07-23 23:30 | 1.9M | |
![[ ]](/icons/compressed.gif) | wolf.jpg.gz | 2005-07-23 23:30 | 261K | |
![[ ]](/icons/compressed.gif) | wool becomes yarn.jpg.gz | 2005-07-23 23:30 | 1.1M | |
![[ ]](/icons/compressed.gif) | workshop close up.jpg.gz | 2005-07-23 23:30 | 327K | |
![[ ]](/icons/compressed.gif) | yarn dying.jpg.gz | 2005-07-23 23:30 | 1.0M | |
![[ ]](/icons/compressed.gif) | yarn stock.jpg.gz | 2005-07-23 23:30 | 608K | |
![[ ]](/icons/compressed.gif) | young woman in Gangtok.jpg.gz | 2005-07-23 23:30 | 1.1M | |
|